C19H37N5O3Si3 — CID 6431571
N-trimethylsilyl-9-[(4R,5S)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]purin-6-amine (PubChem CID 6431571) has the molecular formula C19H37N5O3Si3 and a molecular weight of 467.80 g/mol. Its IUPAC name is N-trimethylsilyl-9-[(4R,5S)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]purin-6-amine.
| Compound Name | N-trimethylsilyl-9-[(4R,5S)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 6431571 |
| Molecular Formula | C19H37N5O3Si3 |
| Molecular Weight | 467.80 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-trimethylsilyl-9-[(4R,5S)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]purin-6-amine |
| SMILES | C[Si](C)(C)Nc1ncnc2c1ncn2C1C[C@@H](O[Si](C)(C)C)[C@H](CO[Si](C)(C)C)O1 |
| InChI | InChI=1S/C19H37N5O3Si3/c1-28(2,3)23-18-17-19(21-12-20-18)24(13-22-17)16-10-14(27-30(7,8)9)15(26-16)11-25-29(4,5)6/h12-16H,10-11H2,1-9H3,(H,20,21,23)/t14-,15+,16?/m1/s1 |
| InChIKey | PSEZCYIEJIOFHY-YSPPHNQVSA-N |
| XLogP | 4.43 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|