C21H41N5O3SSi3 — CID 552499
9-[5-(ethylsulfanylmethyl)-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-N-trimethylsilylpurin-6-amine (PubChem CID 552499) has the molecular formula C21H41N5O3SSi3 and a molecular weight of 527.92 g/mol. Its IUPAC name is 9-[5-(ethylsulfanylmethyl)-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-N-trimethylsilylpurin-6-amine.
| Compound Name | 9-[5-(ethylsulfanylmethyl)-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-N-trimethylsilylpurin-6-amine |
|---|---|
| PubChem CID | 552499 |
| Molecular Formula | C21H41N5O3SSi3 |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 9-[5-(ethylsulfanylmethyl)-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-N-trimethylsilylpurin-6-amine |
| SMILES | CCSCC1OC(n2cnc3c(N[Si](C)(C)C)ncnc32)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C21H41N5O3SSi3/c1-11-30-12-15-17(28-32(5,6)7)18(29-33(8,9)10)21(27-15)26-14-24-16-19(25-31(2,3)4)22-13-23-20(16)26/h13-15,17-18,21H,11-12H2,1-10H3,(H,22,23,25) |
| InChIKey | FXZIMTBHDHLQLB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|