C22H42N6O3Si2 — CID 11454734
9-[(2R,3R,4R,5R)-5-(aminomethyl)-3,4-bis(triethylsilyloxy)oxolan-2-yl]purin-6-amine (PubChem CID 11454734) has the molecular formula C22H42N6O3Si2 and a molecular weight of 494.79 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-5-(aminomethyl)-3,4-bis(triethylsilyloxy)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,3R,4R,5R)-5-(aminomethyl)-3,4-bis(triethylsilyloxy)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 11454734 |
| Molecular Formula | C22H42N6O3Si2 |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-5-(aminomethyl)-3,4-bis(triethylsilyloxy)oxolan-2-yl]purin-6-amine |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](O[Si](CC)(CC)CC)[C@@H](CN)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C22H42N6O3Si2/c1-7-32(8-2,9-3)30-18-16(13-23)29-22(19(18)31-33(10-4,11-5)12-6)28-15-27-17-20(24)25-14-26-21(17)28/h14-16,18-19,22H,7-13,23H2,1-6H3,(H2,24,25,26)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | JQIXQRQQRXRZGN-WGQQHEPDSA-N |
| XLogP | 4.05 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|