C26H46N6O5Si2 — CID 89347003
methyl 1-[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-bis(triethylsilyloxy)oxolan-2-yl]methyl]aziridine-2-carboxylate (PubChem CID 89347003) has the molecular formula C26H46N6O5Si2 and a molecular weight of 578.86 g/mol. Its IUPAC name is methyl 1-[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-bis(triethylsilyloxy)oxolan-2-yl]methyl]aziridine-2-carboxylate.
| Compound Name | methyl 1-[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-bis(triethylsilyloxy)oxolan-2-yl]methyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 89347003 |
| Molecular Formula | C26H46N6O5Si2 |
| Molecular Weight | 578.86 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | methyl 1-[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-bis(triethylsilyloxy)oxolan-2-yl]methyl]aziridine-2-carboxylate |
| SMILES | CC[Si](CC)(CC)OC1[C@@H](O[Si](CC)(CC)CC)[C@@H](CN2CC2C(=O)OC)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C26H46N6O5Si2/c1-8-38(9-2,10-3)36-21-19(15-31-14-18(31)26(33)34-7)35-25(22(21)37-39(11-4,12-5)13-6)32-17-30-20-23(27)28-16-29-24(20)32/h16-19,21-22,25H,8-15H2,1-7H3,(H2,27,28,29)/t18?,19-,21+,22?,25-,31?/m1/s1 |
| InChIKey | ZQTRXSMEQLIWCM-FYNPAIHDSA-N |
| XLogP | 3.94 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|