C25H53N5O5Si5 — CID 91746614
9-[(2S,3S,4S,5S)-3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]-N-trimethylsilyl-6-trimethylsilyloxypurin-2-amine (PubChem CID 91746614) has the molecular formula C25H53N5O5Si5 and a molecular weight of 644.16 g/mol. Its IUPAC name is 9-[(2S,3S,4S,5S)-3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]-N-trimethylsilyl-6-trimethylsilyloxypurin-2-amine.
| Compound Name | 9-[(2S,3S,4S,5S)-3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]-N-trimethylsilyl-6-trimethylsilyloxypurin-2-amine |
|---|---|
| PubChem CID | 91746614 |
| Molecular Formula | C25H53N5O5Si5 |
| Molecular Weight | 644.16 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | 9-[(2S,3S,4S,5S)-3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]-N-trimethylsilyl-6-trimethylsilyloxypurin-2-amine |
| SMILES | C[Si](C)(C)Nc1nc(O[Si](C)(C)C)c2ncn([C@H]3O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C25H53N5O5Si5/c1-36(2,3)29-25-27-22-19(23(28-25)35-40(13,14)15)26-17-30(22)24-21(34-39(10,11)12)20(33-38(7,8)9)18(32-24)16-31-37(4,5)6/h17-18,20-21,24H,16H2,1-15H3,(H,27,28,29)/t18-,20-,21-,24-/m0/s1 |
| InChIKey | WBZAZQAAZNLPHS-FVLCUVFVSA-N |
| XLogP | 6.48 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.16 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|