C41H64N4O5Si3 — CID 139257485
[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-methoxy-2-(3-phenylphenyl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 139257485) has the molecular formula C41H64N4O5Si3 and a molecular weight of 777.24 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-methoxy-2-(3-phenylphenyl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-methoxy-2-(3-phenylphenyl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 139257485 |
| Molecular Formula | C41H64N4O5Si3 |
| Molecular Weight | 777.24 g/mol |
| Exact Mass | 776.42 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-methoxy-2-(3-phenylphenyl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COc1nc(-c2cccc(-c3ccccc3)c2)nc2c1ncn2[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H64N4O5Si3/c1-39(2,3)51(11,12)47-26-31-33(49-52(13,14)40(4,5)6)34(50-53(15,16)41(7,8)9)38(48-31)45-27-42-32-36(45)43-35(44-37(32)46-10)30-24-20-23-29(25-30)28-21-18-17-19-22-28/h17-25,27,31,33-34,38H,26H2,1-16H3/t31-,33-,34-,38-/m1/s1 |
| InChIKey | ZZEWXAIZHOXIRE-CJEGOSRCSA-N |
| XLogP | 10.87 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.24 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|