C34H58N6O7Si3 — CID 11204947
2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1-(3-nitrophenyl)purin-6-one (PubChem CID 11204947) has the molecular formula C34H58N6O7Si3 and a molecular weight of 747.13 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1-(3-nitrophenyl)purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1-(3-nitrophenyl)purin-6-one |
|---|---|
| PubChem CID | 11204947 |
| Molecular Formula | C34H58N6O7Si3 |
| Molecular Weight | 747.13 g/mol |
| Exact Mass | 746.37 |
| IUPAC Name | 2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1-(3-nitrophenyl)purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(=O)n(-c4cccc([N+](=O)[O-])c4)c(N)nc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H58N6O7Si3/c1-32(2,3)48(10,11)44-20-24-26(46-49(12,13)33(4,5)6)27(47-50(14,15)34(7,8)9)30(45-24)38-21-36-25-28(38)37-31(35)39(29(25)41)22-17-16-18-23(19-22)40(42)43/h16-19,21,24,26-27,30H,20H2,1-15H3,(H2,35,37)/t24-,26-,27-,30-/m1/s1 |
| InChIKey | YRDJMZCCDGPVRM-BQOYKFDPSA-N |
| XLogP | 7.77 |
| TPSA | 158.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.13 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|