C30H37N5O5Si — CID 15403610
9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-1-benzylpurin-6-one (PubChem CID 15403610) has the molecular formula C30H37N5O5Si and a molecular weight of 575.74 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-1-benzylpurin-6-one.
| Compound Name | 9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-1-benzylpurin-6-one |
|---|---|
| PubChem CID | 15403610 |
| Molecular Formula | C30H37N5O5Si |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-1-benzylpurin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(=O)n(Cc4ccccc4)c(N)nc32)[C@@H]2OC(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C30H37N5O5Si/c1-30(2,3)41(4,5)37-17-21-23-24(40-28(39-23)20-14-10-7-11-15-20)27(38-21)35-18-32-22-25(35)33-29(31)34(26(22)36)16-19-12-8-6-9-13-19/h6-15,18,21,23-24,27-28H,16-17H2,1-5H3,(H2,31,33)/t21-,23-,24-,27-,28?/m1/s1 |
| InChIKey | RMHXWPLMLWOSLN-YVNNPSHVSA-N |
| XLogP | 4.63 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|