C26H35FN6O5Si — CID 68982666
1-[9-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-fluorophenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-ethylurea (PubChem CID 68982666) has the molecular formula C26H35FN6O5Si and a molecular weight of 558.69 g/mol. Its IUPAC name is 1-[9-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-fluorophenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-ethylurea.
| Compound Name | 1-[9-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-fluorophenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-ethylurea |
|---|---|
| PubChem CID | 68982666 |
| Molecular Formula | C26H35FN6O5Si |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 1-[9-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-fluorophenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(CO[Si](C)(C)C(C)(C)C)C2OC(c3ccc(F)cc3)OC21 |
| InChI | InChI=1S/C26H35FN6O5Si/c1-7-28-25(34)32-21-18-22(30-13-29-21)33(14-31-18)23-20-19(17(36-23)12-35-39(5,6)26(2,3)4)37-24(38-20)15-8-10-16(27)11-9-15/h8-11,13-14,17,19-20,23-24H,7,12H2,1-6H3,(H2,28,29,30,32,34) |
| InChIKey | DGJVJJWPMGIZPX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|