C35H61N5O5Si3 — CID 135491703
2-(benzylamino)-9-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one (PubChem CID 135491703) has the molecular formula C35H61N5O5Si3 and a molecular weight of 716.16 g/mol. Its IUPAC name is 2-(benzylamino)-9-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-(benzylamino)-9-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135491703 |
| Molecular Formula | C35H61N5O5Si3 |
| Molecular Weight | 716.16 g/mol |
| Exact Mass | 715.40 |
| IUPAC Name | 2-(benzylamino)-9-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(n2cnc3c(=O)[nH]c(NCc4ccccc4)nc32)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H61N5O5Si3/c1-33(2,3)46(10,11)42-22-25-27(44-47(12,13)34(4,5)6)28(45-48(14,15)35(7,8)9)31(43-25)40-23-37-26-29(40)38-32(39-30(26)41)36-21-24-19-17-16-18-20-24/h16-20,23,25,27-28,31H,21-22H2,1-15H3,(H2,36,38,39,41) |
| InChIKey | AGALEEVUBIOKBR-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.16 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|