C28H37N5O8Si — CID 135494431
[(2R,3R,4R,5R)-2-(2-benzamido-6-oxo-1H-purin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-yl] 4-oxopentanoate (PubChem CID 135494431) has the molecular formula C28H37N5O8Si and a molecular weight of 599.72 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(2-benzamido-6-oxo-1H-purin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-yl] 4-oxopentanoate.
| Compound Name | [(2R,3R,4R,5R)-2-(2-benzamido-6-oxo-1H-purin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 135494431 |
| Molecular Formula | C28H37N5O8Si |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(2-benzamido-6-oxo-1H-purin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1n1cnc2c(=O)[nH]c(NC(=O)c3ccccc3)nc21 |
| InChI | InChI=1S/C28H37N5O8Si/c1-16(35)12-13-19(36)40-22-21(41-42(5,6)28(2,3)4)18(14-34)39-26(22)33-15-29-20-23(33)30-27(32-25(20)38)31-24(37)17-10-8-7-9-11-17/h7-11,15,18,21-22,26,34H,12-14H2,1-6H3,(H2,30,31,32,37,38)/t18-,21-,22-,26-/m1/s1 |
| InChIKey | BZHSDIDPZMUIMO-IUVOSCESSA-N |
| XLogP | 2.93 |
| TPSA | 174.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|