C23H31N5O6Si — CID 163261814
[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-yl] benzoate (PubChem CID 163261814) has the molecular formula C23H31N5O6Si and a molecular weight of 501.62 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 163261814 |
| Molecular Formula | C23H31N5O6Si |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-yl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OC(=O)c2ccccc2)[C@@H](CO)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C23H31N5O6Si/c1-23(2,3)35(4,5)34-17-16(33-21(31)13-9-7-6-8-10-13)14(11-29)32-20(17)28-12-25-15-18(28)26-22(24)27-19(15)30/h6-10,12,14,16-17,20,29H,11H2,1-5H3,(H3,24,26,27,30)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | OOEXSFXEOOOFIZ-WVSUBDOOSA-N |
| XLogP | 2.21 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|