C17H19BN5O5- — CID 143934412
[(2R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methyloxolan-3-yl]oxy-phenylborinate (PubChem CID 143934412) has the molecular formula C17H19BN5O5- and a molecular weight of 384.18 g/mol. Its IUPAC name is [(2R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methyloxolan-3-yl]oxy-phenylborinate.
| Compound Name | [(2R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methyloxolan-3-yl]oxy-phenylborinate |
|---|---|
| PubChem CID | 143934412 |
| Molecular Formula | C17H19BN5O5- |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [(2R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methyloxolan-3-yl]oxy-phenylborinate |
| SMILES | CC1C(OB([O-])c2ccccc2)[C@@H](CO)OC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C17H19BN5O5/c1-9-13(28-18(26)10-5-3-2-4-6-10)11(7-24)27-16(9)23-8-20-12-14(23)21-17(19)22-15(12)25/h2-6,8-9,11,13,16,24H,7H2,1H3,(H3,19,21,22,25)/q-1/t9?,11-,13?,16?/m1/s1 |
| InChIKey | XAZHKDCRDRFJIE-BEHILSFRSA-N |
| XLogP | -1.63 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|