C29H45N5O6Si2 — CID 136702798
N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]benzamide (PubChem CID 136702798) has the molecular formula C29H45N5O6Si2 and a molecular weight of 615.88 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]benzamide |
|---|---|
| PubChem CID | 136702798 |
| Molecular Formula | C29H45N5O6Si2 |
| Molecular Weight | 615.88 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1n1cnc2c(=O)[nH]c(NC(=O)c3ccccc3)nc21 |
| InChI | InChI=1S/C29H45N5O6Si2/c1-28(2,3)41(7,8)39-21-19(16-35)38-26(22(21)40-42(9,10)29(4,5)6)34-17-30-20-23(34)31-27(33-25(20)37)32-24(36)18-14-12-11-13-15-18/h11-15,17,19,21-22,26,35H,16H2,1-10H3,(H2,31,32,33,36,37)/t19-,21-,22-,26-/m1/s1 |
| InChIKey | FDLCMQSMSBSPLC-RKCWLVDCSA-N |
| XLogP | 5.04 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|