C31H25N5O8 — CID 136918288
[(2R,3S,4S,5R)-5-(2-benzamido-6-oxo-1H-purin-9-yl)-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate (PubChem CID 136918288) has the molecular formula C31H25N5O8 and a molecular weight of 595.57 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(2-benzamido-6-oxo-1H-purin-9-yl)-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R)-5-(2-benzamido-6-oxo-1H-purin-9-yl)-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 136918288 |
| Molecular Formula | C31H25N5O8 |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(2-benzamido-6-oxo-1H-purin-9-yl)-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(Nc1nc2c(ncn2[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@@H]2O)c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C31H25N5O8/c37-23-24(44-30(41)20-14-8-3-9-15-20)21(16-42-29(40)19-12-6-2-7-13-19)43-28(23)36-17-32-22-25(36)33-31(35-27(22)39)34-26(38)18-10-4-1-5-11-18/h1-15,17,21,23-24,28,37H,16H2,(H2,33,34,35,38,39)/t21-,23+,24-,28-/m1/s1 |
| InChIKey | HIJNYMIHLOJOED-ZYPUAGOQSA-N |
| XLogP | 2.71 |
| TPSA | 174.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |