C23H30N8O4Si — CID 136810715
N-[9-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-oxo-1H-purin-2-yl]benzamide (PubChem CID 136810715) has the molecular formula C23H30N8O4Si and a molecular weight of 510.63 g/mol. Its IUPAC name is N-[9-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-oxo-1H-purin-2-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-oxo-1H-purin-2-yl]benzamide |
|---|---|
| PubChem CID | 136810715 |
| Molecular Formula | C23H30N8O4Si |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | N-[9-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-oxo-1H-purin-2-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(NC(=O)c4ccccc4)nc32)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C23H30N8O4Si/c1-23(2,3)36(4,5)34-12-16-15(29-30-24)11-17(35-16)31-13-25-18-19(31)26-22(28-21(18)33)27-20(32)14-9-7-6-8-10-14/h6-10,13,15-17H,11-12H2,1-5H3,(H2,26,27,28,32,33)/t15-,16+,17+/m0/s1 |
| InChIKey | MVHUSIPLZUNDBK-GVDBMIGSSA-N |
| XLogP | 4.36 |
| TPSA | 159.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|