C37H63N5O5Si3 — CID 11765549
N-benzyl-N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]acetamide (PubChem CID 11765549) has the molecular formula C37H63N5O5Si3 and a molecular weight of 742.20 g/mol. Its IUPAC name is N-benzyl-N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]acetamide.
| Compound Name | N-benzyl-N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]acetamide |
|---|---|
| PubChem CID | 11765549 |
| Molecular Formula | C37H63N5O5Si3 |
| Molecular Weight | 742.20 g/mol |
| Exact Mass | 741.41 |
| IUPAC Name | N-benzyl-N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]acetamide |
| SMILES | CC(=O)N(Cc1ccccc1)c1ncnc2c1ncn2[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H63N5O5Si3/c1-26(43)41(22-27-20-18-17-19-21-27)32-29-33(39-24-38-32)42(25-40-29)34-31(47-50(15,16)37(8,9)10)30(46-49(13,14)36(5,6)7)28(45-34)23-44-48(11,12)35(2,3)4/h17-21,24-25,28,30-31,34H,22-23H2,1-16H3/t28-,30-,31-,34-/m1/s1 |
| InChIKey | VPHHOFYMBKGULK-UTBAFCPYSA-N |
| XLogP | 9.08 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.20 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|