C19H30N6O4Si — CID 177475899
N'-[9-[(1R,2R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 177475899) has the molecular formula C19H30N6O4Si and a molecular weight of 434.57 g/mol. Its IUPAC name is N'-[9-[(1R,2R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(1R,2R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 177475899 |
| Molecular Formula | C19H30N6O4Si |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N'-[9-[(1R,2R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nc2c(ncn2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3O[C@H]32)c(=O)[nH]1 |
| InChI | InChI=1S/C19H30N6O4Si/c1-19(2,3)30(6,7)27-8-11-13-14(29-13)17(28-11)25-10-20-12-15(25)22-18(23-16(12)26)21-9-24(4)5/h9-11,13-14,17H,8H2,1-7H3,(H,22,23,26)/b21-9+/t11-,13-,14-,17-/m1/s1 |
| InChIKey | GITOEESEAYTMOS-FKZMKMQHSA-N |
| XLogP | 2.03 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|