C26H37N7O6Si — CID 152500748
N'-[9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 152500748) has the molecular formula C26H37N7O6Si and a molecular weight of 571.71 g/mol. Its IUPAC name is N'-[9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 152500748 |
| Molecular Formula | C26H37N7O6Si |
| Molecular Weight | 571.71 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | N'-[9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1nc2c(ncn2[C@H]2C[C@H](OCc3ccccc3[N+](=O)[O-])[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C26H37N7O6Si/c1-26(2,3)40(6,7)38-14-20-19(37-13-17-10-8-9-11-18(17)33(35)36)12-21(39-20)32-16-27-22-23(32)29-25(30-24(22)34)28-15-31(4)5/h8-11,15-16,19-21H,12-14H2,1-7H3,(H,29,30,34)/t19-,20+,21+/m0/s1 |
| InChIKey | YDKJJKLOTIXVSI-PWRODBHTSA-N |
| XLogP | 4.14 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|