C20H35IN4O5Si — CID 140914364
N'-[1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methoxymethoxy)oxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 140914364) has the molecular formula C20H35IN4O5Si and a molecular weight of 566.51 g/mol. Its IUPAC name is N'-[1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methoxymethoxy)oxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methoxymethoxy)oxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 140914364 |
| Molecular Formula | C20H35IN4O5Si |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | N'-[1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methoxymethoxy)oxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | COCOC1C[C@H](n2cc(I)c(/N=C/N(C)C)nc2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H35IN4O5Si/c1-20(2,3)31(7,8)29-11-16-15(28-13-27-6)9-17(30-16)25-10-14(21)18(23-19(25)26)22-12-24(4)5/h10,12,15-17H,9,11,13H2,1-8H3/b22-12+/t15?,16-,17-/m1/s1 |
| InChIKey | FYOYHWJRJJZLQX-FSENAKKUSA-N |
| XLogP | 3.37 |
| TPSA | 87.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|