C18H30IN3O4Si — CID 58060003
4-amino-1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enoxyoxolan-2-yl]-5-iodopyrimidin-2-one (PubChem CID 58060003) has the molecular formula C18H30IN3O4Si and a molecular weight of 507.45 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enoxyoxolan-2-yl]-5-iodopyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enoxyoxolan-2-yl]-5-iodopyrimidin-2-one |
|---|---|
| PubChem CID | 58060003 |
| Molecular Formula | C18H30IN3O4Si |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 4-amino-1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enoxyoxolan-2-yl]-5-iodopyrimidin-2-one |
| SMILES | C=CCOC1C[C@H](n2cc(I)c(N)nc2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30IN3O4Si/c1-7-8-24-13-9-15(22-10-12(19)16(20)21-17(22)23)26-14(13)11-25-27(5,6)18(2,3)4/h7,10,13-15H,1,8-9,11H2,2-6H3,(H2,20,21,23)/t13?,14-,15-/m1/s1 |
| InChIKey | AOVLAYZOLKOZIK-JVIGXAJISA-N |
| XLogP | 3.31 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|