C15H23N4O13P3 — CID 171418236
[[(2R,3R)-5-[4-amino-5-(3-aminoprop-1-ynyl)-2-oxopyrimidin-1-yl]-3-prop-2-enoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 171418236) has the molecular formula C15H23N4O13P3 and a molecular weight of 560.29 g/mol. Its IUPAC name is [[(2R,3R)-5-[4-amino-5-(3-aminoprop-1-ynyl)-2-oxopyrimidin-1-yl]-3-prop-2-enoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R)-5-[4-amino-5-(3-aminoprop-1-ynyl)-2-oxopyrimidin-1-yl]-3-prop-2-enoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 171418236 |
| Molecular Formula | C15H23N4O13P3 |
| Molecular Weight | 560.29 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | [[(2R,3R)-5-[4-amino-5-(3-aminoprop-1-ynyl)-2-oxopyrimidin-1-yl]-3-prop-2-enoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=CCO[C@@H]1CC(n2cc(C#CCN)c(N)nc2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H23N4O13P3/c1-2-6-28-11-7-13(19-8-10(4-3-5-16)14(17)18-15(19)20)30-12(11)9-29-34(24,25)32-35(26,27)31-33(21,22)23/h2,8,11-13H,1,5-7,9,16H2,(H,24,25)(H,26,27)(H2,17,18,20)(H2,21,22,23)/t11-,12-,13?/m1/s1 |
| InChIKey | RXINYRZKMKYQTL-ZNRZSNADSA-N |
| XLogP | -0.66 |
| TPSA | 265.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.29 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|