C15H24N3O13P3 — CID 146204000
[[5-(4-amino-5-hex-1-ynyl-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 146204000) has the molecular formula C15H24N3O13P3 and a molecular weight of 547.29 g/mol. Its IUPAC name is [[5-(4-amino-5-hex-1-ynyl-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(4-amino-5-hex-1-ynyl-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 146204000 |
| Molecular Formula | C15H24N3O13P3 |
| Molecular Weight | 547.29 g/mol |
| Exact Mass | 547.05 |
| IUPAC Name | [[5-(4-amino-5-hex-1-ynyl-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCCCC#Cc1cn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)nc1N |
| InChI | InChI=1S/C15H24N3O13P3/c1-2-3-4-5-6-10-8-18(15(20)17-14(10)16)13-7-11(19)12(29-13)9-28-33(24,25)31-34(26,27)30-32(21,22)23/h8,11-13,19H,2-4,7,9H2,1H3,(H,24,25)(H,26,27)(H2,16,17,20)(H2,21,22,23) |
| InChIKey | SQVWVMXLUNIHHA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|