C9H15BrN3O13P3 — CID 25245236
[[(5R)-5-(4-amino-5-bromo-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 25245236) has the molecular formula C9H15BrN3O13P3 and a molecular weight of 546.05 g/mol. Its IUPAC name is [[(5R)-5-(4-amino-5-bromo-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(5R)-5-(4-amino-5-bromo-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 25245236 |
| Molecular Formula | C9H15BrN3O13P3 |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 544.90 |
| IUPAC Name | [[(5R)-5-(4-amino-5-bromo-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc(=O)n([C@H]2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)cc1Br |
| InChI | InChI=1S/C9H15BrN3O13P3/c10-4-2-13(9(15)12-8(4)11)7-1-5(14)6(24-7)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h2,5-7,14H,1,3H2,(H,19,20)(H,21,22)(H2,11,12,15)(H2,16,17,18)/t5?,6?,7-/m1/s1 |
| InChIKey | UYPHYZSNRPGPAN-KPGICGJXSA-N |
| XLogP | -0.42 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|