C17H18I2N3O13P3 — CID 90176357
[[(2R,3R,5R)-5-[4-amino-5-[2-(3,5-diiodophenyl)ethynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90176357) has the molecular formula C17H18I2N3O13P3 and a molecular weight of 819.07 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[4-amino-5-[2-(3,5-diiodophenyl)ethynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-[4-amino-5-[2-(3,5-diiodophenyl)ethynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90176357 |
| Molecular Formula | C17H18I2N3O13P3 |
| Molecular Weight | 819.07 g/mol |
| Exact Mass | 818.81 |
| IUPAC Name | [[(2R,3R,5R)-5-[4-amino-5-[2-(3,5-diiodophenyl)ethynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc(=O)n([C@H]2C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)cc1C#Cc1cc(I)cc(I)c1 |
| InChI | InChI=1S/C17H18I2N3O13P3/c18-11-3-9(4-12(19)5-11)1-2-10-7-22(17(24)21-16(10)20)15-6-13(23)14(33-15)8-32-37(28,29)35-38(30,31)34-36(25,26)27/h3-5,7,13-15,23H,6,8H2,(H,28,29)(H,30,31)(H2,20,21,24)(H2,25,26,27)/t13-,14-,15-/m1/s1 |
| InChIKey | PONDPZPLBHQOHW-RBSFLKMASA-N |
| XLogP | 1.43 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.07 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|