C22H30N3O13P3 — CID 123641864
[[5-[4-amino-2-oxo-5-[2-(2,3,4,5,6-pentamethylphenyl)ethynyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123641864) has the molecular formula C22H30N3O13P3 and a molecular weight of 637.41 g/mol. Its IUPAC name is [[5-[4-amino-2-oxo-5-[2-(2,3,4,5,6-pentamethylphenyl)ethynyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-[4-amino-2-oxo-5-[2-(2,3,4,5,6-pentamethylphenyl)ethynyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123641864 |
| Molecular Formula | C22H30N3O13P3 |
| Molecular Weight | 637.41 g/mol |
| Exact Mass | 637.10 |
| IUPAC Name | [[5-[4-amino-2-oxo-5-[2-(2,3,4,5,6-pentamethylphenyl)ethynyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1c(C)c(C)c(C#Cc2cn(C3CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O3)c(=O)nc2N)c(C)c1C |
| InChI | InChI=1S/C22H30N3O13P3/c1-11-12(2)14(4)17(15(5)13(11)3)7-6-16-9-25(22(27)24-21(16)23)20-8-18(26)19(36-20)10-35-40(31,32)38-41(33,34)37-39(28,29)30/h9,18-20,26H,8,10H2,1-5H3,(H,31,32)(H,33,34)(H2,23,24,27)(H2,28,29,30) |
| InChIKey | BZUZMJTUUGGUIU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|