C17H28N3O13P3S2 — CID 11285124
[[(2R,3S,5R)-5-[4-amino-5-[4-(tert-butyldisulfanyl)but-1-ynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 11285124) has the molecular formula C17H28N3O13P3S2 and a molecular weight of 639.47 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[4-amino-5-[4-(tert-butyldisulfanyl)but-1-ynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[4-amino-5-[4-(tert-butyldisulfanyl)but-1-ynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 11285124 |
| Molecular Formula | C17H28N3O13P3S2 |
| Molecular Weight | 639.47 g/mol |
| Exact Mass | 639.03 |
| IUPAC Name | [[(2R,3S,5R)-5-[4-amino-5-[4-(tert-butyldisulfanyl)but-1-ynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)(C)SSCCC#Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)nc1N |
| InChI | InChI=1S/C17H28N3O13P3S2/c1-17(2,3)38-37-7-5-4-6-11-9-20(16(22)19-15(11)18)14-8-12(21)13(31-14)10-30-35(26,27)33-36(28,29)32-34(23,24)25/h9,12-14,21H,5,7-8,10H2,1-3H3,(H,26,27)(H,28,29)(H2,18,19,22)(H2,23,24,25)/t12-,13+,14+/m0/s1 |
| InChIKey | HJHJOELWOYEILM-BFHYXJOUSA-N |
| XLogP | 1.74 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|