C15H25N4O13P3 — CID 15456929
[[(2S,4R,5R)-5-[4-amino-5-(6-aminohex-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 15456929) has the molecular formula C15H25N4O13P3 and a molecular weight of 562.30 g/mol. Its IUPAC name is [[(2S,4R,5R)-5-[4-amino-5-(6-aminohex-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,4R,5R)-5-[4-amino-5-(6-aminohex-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 15456929 |
| Molecular Formula | C15H25N4O13P3 |
| Molecular Weight | 562.30 g/mol |
| Exact Mass | 562.06 |
| IUPAC Name | [[(2S,4R,5R)-5-[4-amino-5-(6-aminohex-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCCCCC#Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@H]2O)c(=O)nc1N |
| InChI | InChI=1S/C15H25N4O13P3/c16-6-4-2-1-3-5-10-8-19(15(21)18-13(10)17)14-12(20)7-11(30-14)9-29-34(25,26)32-35(27,28)31-33(22,23)24/h8,11-12,14,20H,1-2,4,6-7,9,16H2,(H,25,26)(H,27,28)(H2,17,18,21)(H2,22,23,24)/t11-,12+,14+/m0/s1 |
| InChIKey | RLXDDILTDFQKAW-OUCADQQQSA-N |
| XLogP | -0.70 |
| TPSA | 276.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.30 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|