C14H23N4O13P3 — CID 54341070
[[(2S,4R,5R)-5-[4-amino-5-(5-aminopent-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 54341070) has the molecular formula C14H23N4O13P3 and a molecular weight of 548.28 g/mol. Its IUPAC name is [[(2S,4R,5R)-5-[4-amino-5-(5-aminopent-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,4R,5R)-5-[4-amino-5-(5-aminopent-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 54341070 |
| Molecular Formula | C14H23N4O13P3 |
| Molecular Weight | 548.28 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | [[(2S,4R,5R)-5-[4-amino-5-(5-aminopent-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCCCC#Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@H]2O)c(=O)nc1N |
| InChI | InChI=1S/C14H23N4O13P3/c15-5-3-1-2-4-9-7-18(14(20)17-12(9)16)13-11(19)6-10(29-13)8-28-33(24,25)31-34(26,27)30-32(21,22)23/h7,10-11,13,19H,1,3,5-6,8,15H2,(H,24,25)(H,26,27)(H2,16,17,20)(H2,21,22,23)/t10-,11+,13+/m0/s1 |
| InChIKey | TYZHZJIUBXXPES-DMDPSCGWSA-N |
| XLogP | -1.09 |
| TPSA | 276.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.28 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|