C14H27N8O13P3 — CID 146034905
diamino [[[(2S,4R,5R)-5-[4-amino-5-(5-aminopent-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-aminooxyphosphoryl]oxy-aminooxyphosphoryl] phosphate (PubChem CID 146034905) has the molecular formula C14H27N8O13P3 and a molecular weight of 608.33 g/mol. Its IUPAC name is diamino [[[(2S,4R,5R)-5-[4-amino-5-(5-aminopent-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-aminooxyphosphoryl]oxy-aminooxyphosphoryl] phosphate.
| Compound Name | diamino [[[(2S,4R,5R)-5-[4-amino-5-(5-aminopent-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-aminooxyphosphoryl]oxy-aminooxyphosphoryl] phosphate |
|---|---|
| PubChem CID | 146034905 |
| Molecular Formula | C14H27N8O13P3 |
| Molecular Weight | 608.33 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | diamino [[[(2S,4R,5R)-5-[4-amino-5-(5-aminopent-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-aminooxyphosphoryl]oxy-aminooxyphosphoryl] phosphate |
| SMILES | NCCCC#Cc1cn([C@@H]2O[C@H](COP(=O)(ON)OP(=O)(ON)OP(=O)(ON)ON)C[C@H]2O)c(=O)nc1N |
| InChI | InChI=1S/C14H27N8O13P3/c15-5-3-1-2-4-9-7-22(14(24)21-12(9)16)13-11(23)6-10(29-13)8-28-36(25,30-17)34-38(27,33-20)35-37(26,31-18)32-19/h7,10-11,13,23H,1,3,5-6,8,15,17-20H2,(H2,16,21,24)/t10-,11+,13+,36?,38?/m0/s1 |
| InChIKey | WORPDJADTFILBN-HDKHXMDFSA-N |
| XLogP | -1.50 |
| TPSA | 336.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.33 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|