C14H29N4O16P3 — CID 173190875
4-amino-5-[3-(2-aminoethoxy)prop-1-ynyl]-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;phosphoric acid (PubChem CID 173190875) has the molecular formula C14H29N4O16P3 and a molecular weight of 602.32 g/mol. Its IUPAC name is 4-amino-5-[3-(2-aminoethoxy)prop-1-ynyl]-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;phosphoric acid.
| Compound Name | 4-amino-5-[3-(2-aminoethoxy)prop-1-ynyl]-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;phosphoric acid |
|---|---|
| PubChem CID | 173190875 |
| Molecular Formula | C14H29N4O16P3 |
| Molecular Weight | 602.32 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | 4-amino-5-[3-(2-aminoethoxy)prop-1-ynyl]-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;phosphoric acid |
| SMILES | NCCOCC#Cc1cn([C@H]2CC[C@@H](CO)O2)c(=O)nc1N.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C14H20N4O4.3H3O4P/c15-5-7-21-6-1-2-10-8-18(14(20)17-13(10)16)12-4-3-11(9-19)22-12;3*1-5(2,3)4/h8,11-12,19H,3-7,9,15H2,(H2,16,17,20);3*(H3,1,2,3,4)/t11-,12+;;;/m0.../s1 |
| InChIKey | ASSWBOUHWUNGAF-XRBIFONESA-N |
| XLogP | -3.96 |
| TPSA | 358.90 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.32 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|