C22H24N4O6 — CID 18661133
N-[2-[3-[4-amino-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-ynoxy]ethyl]-2-formylbenzamide (PubChem CID 18661133) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is N-[2-[3-[4-amino-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-ynoxy]ethyl]-2-formylbenzamide.
| Compound Name | N-[2-[3-[4-amino-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-ynoxy]ethyl]-2-formylbenzamide |
|---|---|
| PubChem CID | 18661133 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-[2-[3-[4-amino-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-ynoxy]ethyl]-2-formylbenzamide |
| SMILES | Nc1nc(=O)n([C@H]2CC[C@@H](CO)O2)cc1C#CCOCCNC(=O)c1ccccc1C=O |
| InChI | InChI=1S/C22H24N4O6/c23-20-15(12-26(22(30)25-20)19-8-7-17(14-28)32-19)5-3-10-31-11-9-24-21(29)18-6-2-1-4-16(18)13-27/h1-2,4,6,12-13,17,19,28H,7-11,14H2,(H,24,29)(H2,23,25,30)/t17-,19+/m0/s1 |
| InChIKey | IZVQEVGCABTUHO-PKOBYXMFSA-N |
| XLogP | 0.11 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|