C20H23N4O14P3 — CID 121487847
[[(2S,5R)-5-[4-amino-5-[3-[(4-formylbenzoyl)amino]prop-1-ynyl]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 121487847) has the molecular formula C20H23N4O14P3 and a molecular weight of 636.34 g/mol. Its IUPAC name is [[(2S,5R)-5-[4-amino-5-[3-[(4-formylbenzoyl)amino]prop-1-ynyl]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,5R)-5-[4-amino-5-[3-[(4-formylbenzoyl)amino]prop-1-ynyl]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 121487847 |
| Molecular Formula | C20H23N4O14P3 |
| Molecular Weight | 636.34 g/mol |
| Exact Mass | 636.04 |
| IUPAC Name | [[(2S,5R)-5-[4-amino-5-[3-[(4-formylbenzoyl)amino]prop-1-ynyl]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc(=O)n([C@H]2CC[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)cc1C#CCNC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C20H23N4O14P3/c21-18-15(2-1-9-22-19(26)14-5-3-13(11-25)4-6-14)10-24(20(27)23-18)17-8-7-16(36-17)12-35-40(31,32)38-41(33,34)37-39(28,29)30/h3-6,10-11,16-17H,7-9,12H2,(H,22,26)(H,31,32)(H,33,34)(H2,21,23,27)(H2,28,29,30)/t16-,17+/m0/s1 |
| InChIKey | HCHVKLRBXATZIJ-DLBZAZTESA-N |
| XLogP | 0.44 |
| TPSA | 276.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|