C9H14ClN3O9P2 — CID 164881742
[(2S,5R)-5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 164881742) has the molecular formula C9H14ClN3O9P2 and a molecular weight of 405.62 g/mol. Its IUPAC name is [(2S,5R)-5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2S,5R)-5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 164881742 |
| Molecular Formula | C9H14ClN3O9P2 |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | [(2S,5R)-5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | Nc1nc(=O)n([C@H]2CC[C@@H](COP(=O)(O)OP(=O)(O)O)O2)cc1Cl |
| InChI | InChI=1S/C9H14ClN3O9P2/c10-6-3-13(9(14)12-8(6)11)7-2-1-5(21-7)4-20-24(18,19)22-23(15,16)17/h3,5,7H,1-2,4H2,(H,18,19)(H2,11,12,14)(H2,15,16,17)/t5-,7+/m0/s1 |
| InChIKey | SNZIIRFZDIMTHO-CAHLUQPWSA-N |
| XLogP | 0.38 |
| TPSA | 183.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|