C19H21N4O16P3 — CID 10233303
[5-[4-amino-5-[3-[(4-formylbenzoyl)amino]prop-1-ynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]oxy [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 10233303) has the molecular formula C19H21N4O16P3 and a molecular weight of 654.31 g/mol. Its IUPAC name is [5-[4-amino-5-[3-[(4-formylbenzoyl)amino]prop-1-ynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]oxy [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [5-[4-amino-5-[3-[(4-formylbenzoyl)amino]prop-1-ynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]oxy [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 10233303 |
| Molecular Formula | C19H21N4O16P3 |
| Molecular Weight | 654.31 g/mol |
| Exact Mass | 654.02 |
| IUPAC Name | [5-[4-amino-5-[3-[(4-formylbenzoyl)amino]prop-1-ynyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]oxy [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | Nc1nc(=O)n(C2CC(O)C(OOP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)cc1C#CCNC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C19H21N4O16P3/c20-16-13(2-1-7-21-17(26)12-5-3-11(10-24)4-6-12)9-23(19(27)22-16)15-8-14(25)18(35-15)36-37-41(31,32)39-42(33,34)38-40(28,29)30/h3-6,9-10,14-15,18,25H,7-8H2,(H,21,26)(H,31,32)(H,33,34)(H2,20,22,27)(H2,28,29,30) |
| InChIKey | STVYHJSXXNHTIL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 305.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.31 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|