C26H42N7O13P3 — CID 58932123
[[(2S,5R)-5-[4-amino-5-[3-[6-(6-aminohexanoylamino)hexanoylamino]prop-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 58932123) has the molecular formula C26H42N7O13P3 and a molecular weight of 753.58 g/mol. Its IUPAC name is [[(2S,5R)-5-[4-amino-5-[3-[6-(6-aminohexanoylamino)hexanoylamino]prop-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,5R)-5-[4-amino-5-[3-[6-(6-aminohexanoylamino)hexanoylamino]prop-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 58932123 |
| Molecular Formula | C26H42N7O13P3 |
| Molecular Weight | 753.58 g/mol |
| Exact Mass | 753.21 |
| IUPAC Name | [[(2S,5R)-5-[4-amino-5-[3-[6-(6-aminohexanoylamino)hexanoylamino]prop-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCCCCCC(=O)NCCCCCC(=O)NCC#Cc1cn([C@H]2CC[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c2ncnc(N)c12 |
| InChI | InChI=1S/C26H42N7O13P3/c27-13-5-1-3-9-21(34)29-14-6-2-4-10-22(35)30-15-7-8-19-16-33(26-24(19)25(28)31-18-32-26)23-12-11-20(44-23)17-43-48(39,40)46-49(41,42)45-47(36,37)38/h16,18,20,23H,1-6,9-15,17,27H2,(H,29,34)(H,30,35)(H,39,40)(H,41,42)(H2,28,31,32)(H2,36,37,38)/t20-,23+/m0/s1 |
| InChIKey | SYAYTCGTBKNKEJ-NZQKXSOJSA-N |
| XLogP | 1.70 |
| TPSA | 310.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.58 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|