C20H29N8O13P3 — CID 102084650
[[(2R,3S,5R)-5-[4-amino-5-[5-(4-azidobutylamino)-5-oxopent-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 102084650) has the molecular formula C20H29N8O13P3 and a molecular weight of 682.42 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[4-amino-5-[5-(4-azidobutylamino)-5-oxopent-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[4-amino-5-[5-(4-azidobutylamino)-5-oxopent-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 102084650 |
| Molecular Formula | C20H29N8O13P3 |
| Molecular Weight | 682.42 g/mol |
| Exact Mass | 682.11 |
| IUPAC Name | [[(2R,3S,5R)-5-[4-amino-5-[5-(4-azidobutylamino)-5-oxopent-1-ynyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=NCCCCNC(=O)CCC#Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c2ncnc(N)c12 |
| InChI | InChI=1S/C20H29N8O13P3/c21-19-18-13(5-1-2-6-16(30)23-7-3-4-8-26-27-22)10-28(20(18)25-12-24-19)17-9-14(29)15(39-17)11-38-43(34,35)41-44(36,37)40-42(31,32)33/h10,12,14-15,17,29H,2-4,6-9,11H2,(H,23,30)(H,34,35)(H,36,37)(H2,21,24,25)(H2,31,32,33)/t14-,15+,17+/m0/s1 |
| InChIKey | UDYPGKFTGIONFV-ZMSDIMECSA-N |
| XLogP | 1.34 |
| TPSA | 323.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|