C11H16N5O14P3 — CID 101156092
[[(2R,3S,5R)-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 101156092) has the molecular formula C11H16N5O14P3 and a molecular weight of 535.19 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 101156092 |
| Molecular Formula | C11H16N5O14P3 |
| Molecular Weight | 535.19 g/mol |
| Exact Mass | 534.99 |
| IUPAC Name | [[(2R,3S,5R)-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ncnc2c1c([N+](=O)[O-])cn2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C11H16N5O14P3/c12-10-9-5(16(18)19)2-15(11(9)14-4-13-10)8-1-6(17)7(28-8)3-27-32(23,24)30-33(25,26)29-31(20,21)22/h2,4,6-8,17H,1,3H2,(H,23,24)(H,25,26)(H2,12,13,14)(H2,20,21,22)/t6-,7+,8+/m0/s1 |
| InChIKey | BFIWNNKVDWOAGE-XLPZGREQSA-N |
| XLogP | -0.09 |
| TPSA | 289.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|