C22H29N6O17P3 — CID 44594941
[[(2R,3S,5R)-5-[4-amino-5-[[(1S)-1-(2,6-dinitrophenyl)-2-methylpropoxy]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 44594941) has the molecular formula C22H29N6O17P3 and a molecular weight of 742.42 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[4-amino-5-[[(1S)-1-(2,6-dinitrophenyl)-2-methylpropoxy]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[4-amino-5-[[(1S)-1-(2,6-dinitrophenyl)-2-methylpropoxy]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 44594941 |
| Molecular Formula | C22H29N6O17P3 |
| Molecular Weight | 742.42 g/mol |
| Exact Mass | 742.08 |
| IUPAC Name | [[(2R,3S,5R)-5-[4-amino-5-[[(1S)-1-(2,6-dinitrophenyl)-2-methylpropoxy]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)[C@H](OCc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c2ncnc(N)c12)c1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H29N6O17P3/c1-11(2)20(19-13(27(30)31)4-3-5-14(19)28(32)33)41-8-12-7-26(22-18(12)21(23)24-10-25-22)17-6-15(29)16(43-17)9-42-47(37,38)45-48(39,40)44-46(34,35)36/h3-5,7,10-11,15-17,20,29H,6,8-9H2,1-2H3,(H,37,38)(H,39,40)(H2,23,24,25)(H2,34,35,36)/t15-,16+,17+,20-/m0/s1 |
| InChIKey | XURWMLHRCBBVMB-XLSPSMHOSA-N |
| XLogP | 2.74 |
| TPSA | 341.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|