C22H30N5O16P3 — CID 135936774
[[(2R,3S,5R)-5-[2-amino-5-[[2-methyl-1-(2-nitrophenyl)propoxy]methyl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 135936774) has the molecular formula C22H30N5O16P3 and a molecular weight of 713.42 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[2-amino-5-[[2-methyl-1-(2-nitrophenyl)propoxy]methyl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[2-amino-5-[[2-methyl-1-(2-nitrophenyl)propoxy]methyl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 135936774 |
| Molecular Formula | C22H30N5O16P3 |
| Molecular Weight | 713.42 g/mol |
| Exact Mass | 713.09 |
| IUPAC Name | [[(2R,3S,5R)-5-[2-amino-5-[[2-methyl-1-(2-nitrophenyl)propoxy]methyl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)C(OCc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c2nc(N)[nH]c(=O)c12)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H30N5O16P3/c1-11(2)19(13-5-3-4-6-14(13)27(30)31)39-9-12-8-26(20-18(12)21(29)25-22(23)24-20)17-7-15(28)16(41-17)10-40-45(35,36)43-46(37,38)42-44(32,33)34/h3-6,8,11,15-17,19,28H,7,9-10H2,1-2H3,(H,35,36)(H,37,38)(H2,32,33,34)(H3,23,24,25,29)/t15-,16+,17+,19?/m0/s1 |
| InChIKey | JLZQPWUBAPOJSZ-GDFJXRMTSA-N |
| XLogP | 2.12 |
| TPSA | 318.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|