C24H33N4O16P3 — CID 59189429
[[(2R,3R,5R)-5-[4-amino-3-[[1-(4-methoxy-2-nitrophenyl)-2-methylpropoxy]methyl]pyrrolo[2,3-b]pyridin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 59189429) has the molecular formula C24H33N4O16P3 and a molecular weight of 726.46 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[4-amino-3-[[1-(4-methoxy-2-nitrophenyl)-2-methylpropoxy]methyl]pyrrolo[2,3-b]pyridin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-[4-amino-3-[[1-(4-methoxy-2-nitrophenyl)-2-methylpropoxy]methyl]pyrrolo[2,3-b]pyridin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 59189429 |
| Molecular Formula | C24H33N4O16P3 |
| Molecular Weight | 726.46 g/mol |
| Exact Mass | 726.11 |
| IUPAC Name | [[(2R,3R,5R)-5-[4-amino-3-[[1-(4-methoxy-2-nitrophenyl)-2-methylpropoxy]methyl]pyrrolo[2,3-b]pyridin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | COc1ccc(C(OCc2cn([C@H]3C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O3)c3nccc(N)c23)C(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H33N4O16P3/c1-13(2)23(16-5-4-15(39-3)8-18(16)28(30)31)40-11-14-10-27(24-22(14)17(25)6-7-26-24)21-9-19(29)20(42-21)12-41-46(35,36)44-47(37,38)43-45(32,33)34/h4-8,10,13,19-21,23,29H,9,11-12H2,1-3H3,(H2,25,26)(H,35,36)(H,37,38)(H2,32,33,34)/t19-,20-,21-,23?/m1/s1 |
| InChIKey | SBKJBBUBNQVSLA-VCJJEUFXSA-N |
| XLogP | 3.44 |
| TPSA | 294.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|