C23H31N4O15P3 — CID 59189449
[[(2R,3R,5R)-5-[4-amino-3-[[(1S)-2-methyl-1-(2-nitrophenyl)propoxy]methyl]pyrrolo[2,3-b]pyridin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 59189449) has the molecular formula C23H31N4O15P3 and a molecular weight of 696.44 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[4-amino-3-[[(1S)-2-methyl-1-(2-nitrophenyl)propoxy]methyl]pyrrolo[2,3-b]pyridin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-[4-amino-3-[[(1S)-2-methyl-1-(2-nitrophenyl)propoxy]methyl]pyrrolo[2,3-b]pyridin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 59189449 |
| Molecular Formula | C23H31N4O15P3 |
| Molecular Weight | 696.44 g/mol |
| Exact Mass | 696.10 |
| IUPAC Name | [[(2R,3R,5R)-5-[4-amino-3-[[(1S)-2-methyl-1-(2-nitrophenyl)propoxy]methyl]pyrrolo[2,3-b]pyridin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)[C@H](OCc1cn([C@H]2C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c2nccc(N)c12)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H31N4O15P3/c1-13(2)22(15-5-3-4-6-17(15)27(29)30)38-11-14-10-26(23-21(14)16(24)7-8-25-23)20-9-18(28)19(40-20)12-39-44(34,35)42-45(36,37)41-43(31,32)33/h3-8,10,13,18-20,22,28H,9,11-12H2,1-2H3,(H2,24,25)(H,34,35)(H,36,37)(H2,31,32,33)/t18-,19-,20-,22+/m1/s1 |
| InChIKey | AEHIMBKIAULFMF-VMBXEPDQSA-N |
| XLogP | 3.43 |
| TPSA | 285.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|