C22H30N5O15P3 — CID 118084975
[[(2R,5R)-5-[4-amino-5-[[2-methyl-1-(2-nitrophenyl)propoxy]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118084975) has the molecular formula C22H30N5O15P3 and a molecular weight of 697.42 g/mol. Its IUPAC name is [[(2R,5R)-5-[4-amino-5-[[2-methyl-1-(2-nitrophenyl)propoxy]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-[4-amino-5-[[2-methyl-1-(2-nitrophenyl)propoxy]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118084975 |
| Molecular Formula | C22H30N5O15P3 |
| Molecular Weight | 697.42 g/mol |
| Exact Mass | 697.10 |
| IUPAC Name | [[(2R,5R)-5-[4-amino-5-[[2-methyl-1-(2-nitrophenyl)propoxy]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)C(OCc1cn([C@H]2CC(O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c2ncnc(N)c12)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H30N5O15P3/c1-12(2)20(14-5-3-4-6-15(14)27(29)30)38-9-13-8-26(22-19(13)21(23)24-11-25-22)18-7-16(28)17(40-18)10-39-44(34,35)42-45(36,37)41-43(31,32)33/h3-6,8,11-12,16-18,20,28H,7,9-10H2,1-2H3,(H,34,35)(H,36,37)(H2,23,24,25)(H2,31,32,33)/t16?,17-,18-,20?/m1/s1 |
| InChIKey | WOGXWRHVWDQXKR-SFANZJOMSA-N |
| XLogP | 2.83 |
| TPSA | 298.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|