C17H23N4O16P3 — CID 89403058
[[(2R,3R,5R)-5-[4-amino-5-[(2-nitrophenyl)methoxymethyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 89403058) has the molecular formula C17H23N4O16P3 and a molecular weight of 632.31 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[4-amino-5-[(2-nitrophenyl)methoxymethyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-[4-amino-5-[(2-nitrophenyl)methoxymethyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 89403058 |
| Molecular Formula | C17H23N4O16P3 |
| Molecular Weight | 632.31 g/mol |
| Exact Mass | 632.03 |
| IUPAC Name | [[(2R,3R,5R)-5-[4-amino-5-[(2-nitrophenyl)methoxymethyl]-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc(=O)n([C@H]2C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)cc1COCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N4O16P3/c18-16-11(8-33-7-10-3-1-2-4-12(10)21(24)25)6-20(17(23)19-16)15-5-13(22)14(35-15)9-34-39(29,30)37-40(31,32)36-38(26,27)28/h1-4,6,13-15,22H,5,7-9H2,(H,29,30)(H,31,32)(H2,18,19,23)(H2,26,27,28)/t13-,14-,15-/m1/s1 |
| InChIKey | YFJSEGJNEGOXEL-RBSFLKMASA-N |
| XLogP | 0.44 |
| TPSA | 302.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|