C17H22N3O16P3 — CID 90775012
[hydroxy-[[(2R,3S,5R)-3-hydroxy-5-[5-methyl-3-[(2-nitrophenyl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 90775012) has the molecular formula C17H22N3O16P3 and a molecular weight of 617.29 g/mol. Its IUPAC name is [hydroxy-[[(2R,3S,5R)-3-hydroxy-5-[5-methyl-3-[(2-nitrophenyl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,3S,5R)-3-hydroxy-5-[5-methyl-3-[(2-nitrophenyl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90775012 |
| Molecular Formula | C17H22N3O16P3 |
| Molecular Weight | 617.29 g/mol |
| Exact Mass | 617.02 |
| IUPAC Name | [hydroxy-[[(2R,3S,5R)-3-hydroxy-5-[5-methyl-3-[(2-nitrophenyl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n(Cc2ccccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C17H22N3O16P3/c1-10-7-18(17(23)19(16(10)22)8-11-4-2-3-5-12(11)20(24)25)15-6-13(21)14(34-15)9-33-38(29,30)36-39(31,32)35-37(26,27)28/h2-5,7,13-15,21H,6,8-9H2,1H3,(H,29,30)(H,31,32)(H2,26,27,28)/t13-,14+,15+/m0/s1 |
| InChIKey | MOKZWUGOARBGKH-RRFJBIMHSA-N |
| XLogP | 0.27 |
| TPSA | 276.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|