C17H21N6O15P3 — CID 157259581
[hydroxy-[[(2R,5R)-3-hydroxy-5-[2-[(2-nitrophenyl)methylamino]-6-oxo-1H-purin-9-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 157259581) has the molecular formula C17H21N6O15P3 and a molecular weight of 642.30 g/mol. Its IUPAC name is [hydroxy-[[(2R,5R)-3-hydroxy-5-[2-[(2-nitrophenyl)methylamino]-6-oxo-1H-purin-9-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,5R)-3-hydroxy-5-[2-[(2-nitrophenyl)methylamino]-6-oxo-1H-purin-9-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 157259581 |
| Molecular Formula | C17H21N6O15P3 |
| Molecular Weight | 642.30 g/mol |
| Exact Mass | 642.03 |
| IUPAC Name | [hydroxy-[[(2R,5R)-3-hydroxy-5-[2-[(2-nitrophenyl)methylamino]-6-oxo-1H-purin-9-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(NCc2ccccc2[N+](=O)[O-])nc2c1ncn2[C@H]1CC(O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C17H21N6O15P3/c24-11-5-13(36-12(11)7-35-40(31,32)38-41(33,34)37-39(28,29)30)22-8-19-14-15(22)20-17(21-16(14)25)18-6-9-3-1-2-4-10(9)23(26)27/h1-4,8,11-13,24H,5-7H2,(H,31,32)(H,33,34)(H2,28,29,30)(H2,18,20,21,25)/t11?,12-,13-/m1/s1 |
| InChIKey | QVEADVSHOUUABW-VFRRUGBOSA-N |
| XLogP | 0.63 |
| TPSA | 308.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|