C18H21N3O6 — CID 58520496
1-[(2R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-methyl-3-[(2-nitrophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 58520496) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is 1-[(2R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-methyl-3-[(2-nitrophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-methyl-3-[(2-nitrophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58520496 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-[(2R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-methyl-3-[(2-nitrophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | CC[C@H]1O[C@@H](n2cc(C)c(=O)n(Cc3ccccc3[N+](=O)[O-])c2=O)CC1O |
| InChI | InChI=1S/C18H21N3O6/c1-3-15-14(22)8-16(27-15)19-9-11(2)17(23)20(18(19)24)10-12-6-4-5-7-13(12)21(25)26/h4-7,9,14-16,22H,3,8,10H2,1-2H3/t14?,15-,16-/m1/s1 |
| InChIKey | FXMHZPMAPFFKLL-ANGDWKNPSA-N |
| XLogP | 1.33 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|