C30H39N3O7Si — CID 150017629
3-benzyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 150017629) has the molecular formula C30H39N3O7Si and a molecular weight of 581.74 g/mol. Its IUPAC name is 3-benzyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 3-benzyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 150017629 |
| Molecular Formula | C30H39N3O7Si |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 3-benzyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-nitrophenyl)methoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](OCc3ccccc3[N+](=O)[O-])[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C30H39N3O7Si/c1-21-17-31(29(35)32(28(21)34)18-22-12-8-7-9-13-22)27-16-25(26(40-27)20-39-41(5,6)30(2,3)4)38-19-23-14-10-11-15-24(23)33(36)37/h7-15,17,25-27H,16,18-20H2,1-6H3/t25-,26+,27+/m0/s1 |
| InChIKey | DEPASIPFGQVGHP-OYUWMTPXSA-N |
| XLogP | 5.17 |
| TPSA | 114.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|