C28H45N3O6Si2 — CID 16744944
1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methyl-4-(3-nitrophenyl)pyrimidin-2-one (PubChem CID 16744944) has the molecular formula C28H45N3O6Si2 and a molecular weight of 575.86 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methyl-4-(3-nitrophenyl)pyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methyl-4-(3-nitrophenyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 16744944 |
| Molecular Formula | C28H45N3O6Si2 |
| Molecular Weight | 575.86 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methyl-4-(3-nitrophenyl)pyrimidin-2-one |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c(=O)nc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H45N3O6Si2/c1-19-17-30(26(32)29-25(19)20-13-12-14-21(15-20)31(33)34)24-16-22(37-39(10,11)28(5,6)7)23(36-24)18-35-38(8,9)27(2,3)4/h12-15,17,22-24H,16,18H2,1-11H3/t22-,23+,24+/m0/s1 |
| InChIKey | BXZDIMFAARQFPO-RBZQAINGSA-N |
| XLogP | 6.83 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.86 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|