C30H48N6O6Si2 — CID 11114928
9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-amine (PubChem CID 11114928) has the molecular formula C30H48N6O6Si2 and a molecular weight of 644.92 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-amine.
| Compound Name | 9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-amine |
|---|---|
| PubChem CID | 11114928 |
| Molecular Formula | C30H48N6O6Si2 |
| Molecular Weight | 644.92 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | 9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(OCCc4ccc([N+](=O)[O-])cc4)nc(N)nc32)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H48N6O6Si2/c1-29(2,3)43(7,8)40-18-23-22(42-44(9,10)30(4,5)6)17-24(41-23)35-19-32-25-26(35)33-28(31)34-27(25)39-16-15-20-11-13-21(14-12-20)36(37)38/h11-14,19,22-24H,15-18H2,1-10H3,(H2,31,33,34)/t22-,23+,24+/m0/s1 |
| InChIKey | ZYZPVQMYACLTHX-RBZQAINGSA-N |
| XLogP | 6.64 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.92 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|